C24H18F9N3O4 — CID 146425306
[6,9-dioxo-5,8-bis[[4-(trifluoromethyl)phenyl]methyl]-2,5,8-triazaspiro[3.5]nonan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 146425306) has the molecular formula C24H18F9N3O4 and a molecular weight of 583.41 g/mol. Its IUPAC name is [6,9-dioxo-5,8-bis[[4-(trifluoromethyl)phenyl]methyl]-2,5,8-triazaspiro[3.5]nonan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [6,9-dioxo-5,8-bis[[4-(trifluoromethyl)phenyl]methyl]-2,5,8-triazaspiro[3.5]nonan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 146425306 |
| Molecular Formula | C24H18F9N3O4 |
| Molecular Weight | 583.41 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | [6,9-dioxo-5,8-bis[[4-(trifluoromethyl)phenyl]methyl]-2,5,8-triazaspiro[3.5]nonan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C1CN(Cc2ccc(C(F)(F)F)cc2)C(=O)C2(CNC2OC(=O)C(F)(F)F)N1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H18F9N3O4/c25-22(26,27)15-5-1-13(2-6-15)9-35-11-17(37)36(10-14-3-7-16(8-4-14)23(28,29)30)21(19(35)38)12-34-18(21)40-20(39)24(31,32)33/h1-8,18,34H,9-12H2 |
| InChIKey | LFUDDUGQELDJRE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |