About tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate
tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate (PubChem CID 146425629) has the molecular formula C14H23F2NO2
and a molecular weight of 275.34 g/mol. Its IUPAC name is tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate |
| PubChem CID | 146425629 |
| Molecular Formula | C14H23F2NO2 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCCC(F)(F)[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H23F2NO2/c1-5-6-8-14(15,16)11-7-9-17(10-11)12(18)19-13(2,3)4/h5,11H,1,6-10H2,2-4H3/t11-/m0/s1 |
| InChIKey | LMLNNZNKYIJZNW-NSHDSACASA-N |
| XLogP | 3.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate (CID 146425629) is tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate is C=CCCC(F)(F)[C@H]1CCN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate?
The InChIKey is LMLNNZNKYIJZNW-NSHDSACASA-N. The full InChI is InChI=1S/C14H23F2NO2/c1-5-6-8-14(15,16)11-7-9-17(10-11)12(18)19-13(2,3)4/h5,11H,1,6-10H2,2-4H3/t11-/m0/s1.
What are the key properties of tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate?
tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate has a molecular weight of 275.34 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-3-(1,1-difluoropent-4-enyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 146425629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).