C6H4F8O2 — CID 146426173
1-(1,2-difluoroprop-2-enoxy)-1,1,2,3,3,3-hexafluoropropan-2-ol (PubChem CID 146426173) has the molecular formula C6H4F8O2 and a molecular weight of 260.08 g/mol. Its IUPAC name is 1-(1,2-difluoroprop-2-enoxy)-1,1,2,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 1-(1,2-difluoroprop-2-enoxy)-1,1,2,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 146426173 |
| Molecular Formula | C6H4F8O2 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 1-(1,2-difluoroprop-2-enoxy)-1,1,2,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=C(F)C(F)OC(F)(F)C(O)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F8O2/c1-2(7)3(8)16-6(13,14)4(9,15)5(10,11)12/h3,15H,1H2 |
| InChIKey | XHHIWRAWNOUMEC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |