About 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine
1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine (PubChem CID 146426182) has the molecular formula C8H11F5N2
and a molecular weight of 230.18 g/mol. Its IUPAC name is 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine.
Molecular Properties
| Compound Name | 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine |
| PubChem CID | 146426182 |
| Molecular Formula | C8H11F5N2 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine |
| SMILES | C=C(F)C(N1CCN(F)CC1)C(F)(F)F |
| InChI | InChI=1S/C8H11F5N2/c1-6(9)7(8(10,11)12)14-2-4-15(13)5-3-14/h7H,1-5H2 |
| InChIKey | KXKLTTSMCGEHOE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine?
The IUPAC name of 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine (CID 146426182) is 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine.
What is the SMILES notation for 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine?
The canonical SMILES for 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine is C=C(F)C(N1CCN(F)CC1)C(F)(F)F.
What is the InChIKey of 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine?
The InChIKey is KXKLTTSMCGEHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F5N2/c1-6(9)7(8(10,11)12)14-2-4-15(13)5-3-14/h7H,1-5H2.
What are the key properties of 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine?
1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine has a molecular weight of 230.18 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-(1,1,1,3-tetrafluorobut-3-en-2-yl)piperazine is sourced from PubChem (CID 146426182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).