C8H10F6N2 — CID 146426211
1-fluoro-4-(1,1,1,2,3-pentafluorobut-3-en-2-yl)piperazine (PubChem CID 146426211) has the molecular formula C8H10F6N2 and a molecular weight of 248.17 g/mol. Its IUPAC name is 1-fluoro-4-(1,1,1,2,3-pentafluorobut-3-en-2-yl)piperazine.
| Compound Name | 1-fluoro-4-(1,1,1,2,3-pentafluorobut-3-en-2-yl)piperazine |
|---|---|
| PubChem CID | 146426211 |
| Molecular Formula | C8H10F6N2 |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-fluoro-4-(1,1,1,2,3-pentafluorobut-3-en-2-yl)piperazine |
| SMILES | C=C(F)C(F)(N1CCN(F)CC1)C(F)(F)F |
| InChI | InChI=1S/C8H10F6N2/c1-6(9)7(10,8(11,12)13)15-2-4-16(14)5-3-15/h1-5H2 |
| InChIKey | ZHXQRJQZPRDQFO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|