C26H29NO3 — CID 14642638
(3R,5S)-3,4,5-tris(phenylmethoxy)piperidine (PubChem CID 14642638) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is (3R,5S)-3,4,5-tris(phenylmethoxy)piperidine.
| Compound Name | (3R,5S)-3,4,5-tris(phenylmethoxy)piperidine |
|---|---|
| PubChem CID | 14642638 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (3R,5S)-3,4,5-tris(phenylmethoxy)piperidine |
| SMILES | c1ccc(COC2[C@@H](OCc3ccccc3)CNC[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29NO3/c1-4-10-21(11-5-1)18-28-24-16-27-17-25(29-19-22-12-6-2-7-13-22)26(24)30-20-23-14-8-3-9-15-23/h1-15,24-27H,16-20H2/t24-,25+,26? |
| InChIKey | DWZXRUXEJHSRMU-IQCGEYIDSA-N |
| XLogP | 4.35 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |