C22H26FN7O2 — CID 146426598
5-(5-fluoro-1-propan-2-yl-3a,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-N-[(1R,2S)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 146426598) has the molecular formula C22H26FN7O2 and a molecular weight of 439.50 g/mol. Its IUPAC name is 5-(5-fluoro-1-propan-2-yl-3a,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-N-[(1R,2S)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-(5-fluoro-1-propan-2-yl-3a,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-N-[(1R,2S)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 146426598 |
| Molecular Formula | C22H26FN7O2 |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 5-(5-fluoro-1-propan-2-yl-3a,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-N-[(1R,2S)-2-hydroxycyclobutyl]-7-(methylamino)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CNc1cc(C2=CN(C(C)C)C3N=CC(F)=CC23)nc2c(C(=O)N[C@@H]3CC[C@@H]3O)cnn12 |
| InChI | InChI=1S/C22H26FN7O2/c1-11(2)29-10-15(13-6-12(23)8-25-20(13)29)17-7-19(24-3)30-21(27-17)14(9-26-30)22(32)28-16-4-5-18(16)31/h6-11,13,16,18,20,24,31H,4-5H2,1-3H3,(H,28,32)/t13?,16-,18+,20?/m1/s1 |
| InChIKey | PHBQRCXMYRAMRT-AREWKCRZSA-N |
| XLogP | 1.97 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |