About thieno[2,3-d]pyrimidine-2,4-diamine
thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 14642747) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is thieno[2,3-d]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | thieno[2,3-d]pyrimidine-2,4-diamine |
| PubChem CID | 14642747 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C6H6N4S/c7-4-3-1-2-11-5(3)10-6(8)9-4/h1-2H,(H4,7,8,9,10) |
| InChIKey | WWNLEICCMKSWQV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze thieno[2,3-d]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-d]pyrimidine-2,4-diamine?
The IUPAC name of thieno[2,3-d]pyrimidine-2,4-diamine (CID 14642747) is thieno[2,3-d]pyrimidine-2,4-diamine.
What is the SMILES notation for thieno[2,3-d]pyrimidine-2,4-diamine?
The canonical SMILES for thieno[2,3-d]pyrimidine-2,4-diamine is Nc1nc(N)c2ccsc2n1.
What is the InChIKey of thieno[2,3-d]pyrimidine-2,4-diamine?
The InChIKey is WWNLEICCMKSWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c7-4-3-1-2-11-5(3)10-6(8)9-4/h1-2H,(H4,7,8,9,10).
What are the key properties of thieno[2,3-d]pyrimidine-2,4-diamine?
thieno[2,3-d]pyrimidine-2,4-diamine has a molecular weight of 166.21 g/mol, XLogP of 0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-d]pyrimidine-2,4-diamine is sourced from PubChem (CID 14642747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).