C19H24BrFN8O3 — CID 146427714
2-[3-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]propyl]-1-pentylguanidine (PubChem CID 146427714) has the molecular formula C19H24BrFN8O3 and a molecular weight of 511.36 g/mol. Its IUPAC name is 2-[3-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]propyl]-1-pentylguanidine.
| Compound Name | 2-[3-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]propyl]-1-pentylguanidine |
|---|---|
| PubChem CID | 146427714 |
| Molecular Formula | C19H24BrFN8O3 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-[3-[[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-1,2,4-oxadiazol-3-yl]-1,2,5-oxadiazol-3-yl]amino]propyl]-1-pentylguanidine |
| SMILES | CCCCCN/C(N)=N/CCCNc1nonc1-c1noc(=O)n1-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C19H24BrFN8O3/c1-2-3-4-8-24-18(22)25-10-5-9-23-16-15(26-32-27-16)17-28-31-19(30)29(17)12-6-7-14(21)13(20)11-12/h6-7,11H,2-5,8-10H2,1H3,(H,23,27)(H3,22,24,25) |
| InChIKey | LFCVTSAVBLZKFH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 149.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|