C24H23F3N4O2 — CID 146427866
(4aS)-3-(pyrimidin-2-ylmethyl)-9-[4-(trifluoromethyl)phenyl]-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-11-ol (PubChem CID 146427866) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is (4aS)-3-(pyrimidin-2-ylmethyl)-9-[4-(trifluoromethyl)phenyl]-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-11-ol.
| Compound Name | (4aS)-3-(pyrimidin-2-ylmethyl)-9-[4-(trifluoromethyl)phenyl]-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-11-ol |
|---|---|
| PubChem CID | 146427866 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (4aS)-3-(pyrimidin-2-ylmethyl)-9-[4-(trifluoromethyl)phenyl]-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-11-ol |
| SMILES | OC1c2cc(-c3ccc(C(F)(F)F)cc3)ccc2OC[C@@H]2CN(Cc3ncccn3)CCN12 |
| InChI | InChI=1S/C24H23F3N4O2/c25-24(26,27)18-5-2-16(3-6-18)17-4-7-21-20(12-17)23(32)31-11-10-30(13-19(31)15-33-21)14-22-28-8-1-9-29-22/h1-9,12,19,23,32H,10-11,13-15H2/t19-,23?/m0/s1 |
| InChIKey | CNTRLKMKQYWBBO-HSTJUUNISA-N |
| XLogP | 3.73 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |