C24H24F5N — CID 146427890
2-[1-(3,3-difluorocyclobutyl)ethenyl]-8-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 146427890) has the molecular formula C24H24F5N and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-[1-(3,3-difluorocyclobutyl)ethenyl]-8-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 2-[1-(3,3-difluorocyclobutyl)ethenyl]-8-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 146427890 |
| Molecular Formula | C24H24F5N |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[1-(3,3-difluorocyclobutyl)ethenyl]-8-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | C=C(C1CC(F)(F)C1)N1CCCc2ccc(-c3ccc(CC(F)(F)F)cc3)cc2C1 |
| InChI | InChI=1S/C24H24F5N/c1-16(22-13-23(25,26)14-22)30-10-2-3-18-8-9-20(11-21(18)15-30)19-6-4-17(5-7-19)12-24(27,28)29/h4-9,11,22H,1-3,10,12-15H2 |
| InChIKey | ZKHNYUKMVXMZNM-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |