C27H34F2N4O3 — CID 146427952
2-[2-(3,3-difluorocyclobutyl)-3-pyridinyl]-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146427952) has the molecular formula C27H34F2N4O3 and a molecular weight of 500.59 g/mol. Its IUPAC name is 2-[2-(3,3-difluorocyclobutyl)-3-pyridinyl]-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(3,3-difluorocyclobutyl)-3-pyridinyl]-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146427952 |
| Molecular Formula | C27H34F2N4O3 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 2-[2-(3,3-difluorocyclobutyl)-3-pyridinyl]-2-[3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1cccnc1C1CC(F)(F)C1)N1CCC(OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C27H34F2N4O3/c28-27(29)15-19(16-27)23-22(7-4-11-30-23)24(26(34)35)33-13-10-21(17-33)36-14-2-1-6-20-9-8-18-5-3-12-31-25(18)32-20/h4,7-9,11,19,21,24H,1-3,5-6,10,12-17H2,(H,31,32)(H,34,35) |
| InChIKey | LMOMZGOBHBNAPP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|