C29H40FN3O4 — CID 146427992
2-[5-fluoro-2-(oxolan-3-yl)phenyl]-1-methoxy-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]ethanol (PubChem CID 146427992) has the molecular formula C29H40FN3O4 and a molecular weight of 513.65 g/mol. Its IUPAC name is 2-[5-fluoro-2-(oxolan-3-yl)phenyl]-1-methoxy-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]ethanol.
| Compound Name | 2-[5-fluoro-2-(oxolan-3-yl)phenyl]-1-methoxy-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 146427992 |
| Molecular Formula | C29H40FN3O4 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 2-[5-fluoro-2-(oxolan-3-yl)phenyl]-1-methoxy-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]ethanol |
| SMILES | COC(O)C(c1cc(F)ccc1C1CCOC1)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C29H40FN3O4/c1-35-29(34)27(26-17-22(30)8-10-25(26)21-12-16-36-19-21)33-14-11-24(18-33)37-15-3-2-6-23-9-7-20-5-4-13-31-28(20)32-23/h7-10,17,21,24,27,29,34H,2-6,11-16,18-19H2,1H3,(H,31,32)/t21?,24-,27?,29?/m1/s1 |
| InChIKey | MOXAGLCFCIETOE-CIDHDHITSA-N |
| XLogP | 4.20 |
| TPSA | 76.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|