C8H11F3N2O2S — CID 146428144
5-methyl-1-(2-methylsulfonylethyl)-3-(trifluoromethyl)pyrazole (PubChem CID 146428144) has the molecular formula C8H11F3N2O2S and a molecular weight of 256.25 g/mol. Its IUPAC name is 5-methyl-1-(2-methylsulfonylethyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 5-methyl-1-(2-methylsulfonylethyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 146428144 |
| Molecular Formula | C8H11F3N2O2S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-methyl-1-(2-methylsulfonylethyl)-3-(trifluoromethyl)pyrazole |
| SMILES | Cc1cc(C(F)(F)F)nn1CCS(C)(=O)=O |
| InChI | InChI=1S/C8H11F3N2O2S/c1-6-5-7(8(9,10)11)12-13(6)3-4-16(2,14)15/h5H,3-4H2,1-2H3 |
| InChIKey | VCXQUNCDVFOICZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |