C22H32N4O — CID 146429442
N-[2-(4-ethylphenyl)butan-2-yl]-8,8-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a][1,3]diazepine-3-carboxamide (PubChem CID 146429442) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is N-[2-(4-ethylphenyl)butan-2-yl]-8,8-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a][1,3]diazepine-3-carboxamide.
| Compound Name | N-[2-(4-ethylphenyl)butan-2-yl]-8,8-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a][1,3]diazepine-3-carboxamide |
|---|---|
| PubChem CID | 146429442 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | N-[2-(4-ethylphenyl)butan-2-yl]-8,8-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a][1,3]diazepine-3-carboxamide |
| SMILES | CCc1ccc(C(C)(CC)NC(=O)c2cnn3c2NCCCC3(C)C)cc1 |
| InChI | InChI=1S/C22H32N4O/c1-6-16-9-11-17(12-10-16)22(5,7-2)25-20(27)18-15-24-26-19(18)23-14-8-13-21(26,3)4/h9-12,15,23H,6-8,13-14H2,1-5H3,(H,25,27) |
| InChIKey | LJCGKLDZNZQBMC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |