C17H32N2 — CID 146429469
(2E)-N,2,6-trimethyl-4-methylimino-5-propan-2-yl-N-propylhepta-2,6-dien-1-amine (PubChem CID 146429469) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is (2E)-N,2,6-trimethyl-4-methylimino-5-propan-2-yl-N-propylhepta-2,6-dien-1-amine.
| Compound Name | (2E)-N,2,6-trimethyl-4-methylimino-5-propan-2-yl-N-propylhepta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 146429469 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | (2E)-N,2,6-trimethyl-4-methylimino-5-propan-2-yl-N-propylhepta-2,6-dien-1-amine |
| SMILES | C=C(C)C(C(/C=C(\C)CN(C)CCC)=N/C)C(C)C |
| InChI | InChI=1S/C17H32N2/c1-9-10-19(8)12-15(6)11-16(18-7)17(13(2)3)14(4)5/h11,14,17H,2,9-10,12H2,1,3-8H3/b15-11+,18-16+ |
| InChIKey | HWYWKSWVOGFWMT-VJYQPPNCSA-N |
| XLogP | 4.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|