About 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine
5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine (PubChem CID 146429544) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 146429544 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine |
| SMILES | CC1C=C(N)C=C(CCCCC(C)(C)C)C1 |
| InChI | InChI=1S/C15H27N/c1-12-9-13(11-14(16)10-12)7-5-6-8-15(2,3)4/h10-12H,5-9,16H2,1-4H3 |
| InChIKey | WEUHNCYDVJJKCD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine (CID 146429544) is 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine is CC1C=C(N)C=C(CCCCC(C)(C)C)C1.
What is the InChIKey of 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine?
The InChIKey is WEUHNCYDVJJKCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-12-9-13(11-14(16)10-12)7-5-6-8-15(2,3)4/h10-12H,5-9,16H2,1-4H3.
What are the key properties of 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine?
5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine has a molecular weight of 221.39 g/mol, XLogP of 4.40, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5,5-dimethylhexyl)-3-methylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 146429544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).