C11H25O2PS — CID 146429786
2-(3,3-dimethylbutoxy)butan-2-yl-methoxyphosphinothious acid (PubChem CID 146429786) has the molecular formula C11H25O2PS and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-(3,3-dimethylbutoxy)butan-2-yl-methoxyphosphinothious acid.
| Compound Name | 2-(3,3-dimethylbutoxy)butan-2-yl-methoxyphosphinothious acid |
|---|---|
| PubChem CID | 146429786 |
| Molecular Formula | C11H25O2PS |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(3,3-dimethylbutoxy)butan-2-yl-methoxyphosphinothious acid |
| SMILES | CCC(C)(OCCC(C)(C)C)P(S)OC |
| InChI | InChI=1S/C11H25O2PS/c1-7-11(5,14(15)12-6)13-9-8-10(2,3)4/h15H,7-9H2,1-6H3 |
| InChIKey | APGSDCYFVJOHKA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|