C35H48N4O8 — CID 146429889
5-amino-N-(2-aminoethyl)-2-[[2-[6-ethoxy-8-hydroxy-2-methoxy-1,7-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyacetyl]amino]pentanamide (PubChem CID 146429889) has the molecular formula C35H48N4O8 and a molecular weight of 652.79 g/mol. Its IUPAC name is 5-amino-N-(2-aminoethyl)-2-[[2-[6-ethoxy-8-hydroxy-2-methoxy-1,7-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyacetyl]amino]pentanamide.
| Compound Name | 5-amino-N-(2-aminoethyl)-2-[[2-[6-ethoxy-8-hydroxy-2-methoxy-1,7-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyacetyl]amino]pentanamide |
|---|---|
| PubChem CID | 146429889 |
| Molecular Formula | C35H48N4O8 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | 5-amino-N-(2-aminoethyl)-2-[[2-[6-ethoxy-8-hydroxy-2-methoxy-1,7-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxyacetyl]amino]pentanamide |
| SMILES | CCOc1cc2oc3cc(OCC(=O)NC(CCCN)C(=O)NCCN)c(OC)c(CC=C(C)C)c3c(=O)c2c(O)c1CC=C(C)C |
| InChI | InChI=1S/C35H48N4O8/c1-7-45-25-17-27-31(32(41)22(25)12-10-20(2)3)33(42)30-23(13-11-21(4)5)34(44-6)28(18-26(30)47-27)46-19-29(40)39-24(9-8-14-36)35(43)38-16-15-37/h10-11,17-18,24,41H,7-9,12-16,19,36-37H2,1-6H3,(H,38,43)(H,39,40) |
| InChIKey | XEKSPXBYIATAGR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 188.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|