C9H13NO — CID 146429901
2-methyl-2,3,4,5-tetrahydro-1-benzofuran-4-amine (PubChem CID 146429901) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-methyl-2,3,4,5-tetrahydro-1-benzofuran-4-amine.
| Compound Name | 2-methyl-2,3,4,5-tetrahydro-1-benzofuran-4-amine |
|---|---|
| PubChem CID | 146429901 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-methyl-2,3,4,5-tetrahydro-1-benzofuran-4-amine |
| SMILES | CC1CC2=C(C=CCC2N)O1 |
| InChI | InChI=1S/C9H13NO/c1-6-5-7-8(10)3-2-4-9(7)11-6/h2,4,6,8H,3,5,10H2,1H3 |
| InChIKey | KCKNDFPMLLFETP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |