About N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide
N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide (PubChem CID 146429918) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide.
Molecular Properties
| Compound Name | N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide |
| PubChem CID | 146429918 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide |
| SMILES | C=NCN(C)/C=N/CCC |
| InChI | InChI=1S/C7H15N3/c1-4-5-9-7-10(3)6-8-2/h7H,2,4-6H2,1,3H3/b9-7+ |
| InChIKey | ZKASCQDHUREKQE-VQHVLOKHSA-N |
| XLogP | 1.01 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide?
The IUPAC name of N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide (CID 146429918) is N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide.
What is the SMILES notation for N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide?
The canonical SMILES for N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide is C=NCN(C)/C=N/CCC.
What is the InChIKey of N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide?
The InChIKey is ZKASCQDHUREKQE-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H15N3/c1-4-5-9-7-10(3)6-8-2/h7H,2,4-6H2,1,3H3/b9-7+.
What are the key properties of N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide?
N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide has a molecular weight of 141.22 g/mol, XLogP of 1.01, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(methylideneamino)methyl]-N'-propylmethanimidamide is sourced from PubChem (CID 146429918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).