C26H37ClF2N2O2 — CID 146430754
tert-butyl 3-[6-[(E)-2-chloro-2-(2-methyl-3-pyridinyl)ethenyl]-1,1-difluoro-7-methyloct-6-enyl]pyrrolidine-1-carboxylate (PubChem CID 146430754) has the molecular formula C26H37ClF2N2O2 and a molecular weight of 483.04 g/mol. Its IUPAC name is tert-butyl 3-[6-[(E)-2-chloro-2-(2-methyl-3-pyridinyl)ethenyl]-1,1-difluoro-7-methyloct-6-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-[(E)-2-chloro-2-(2-methyl-3-pyridinyl)ethenyl]-1,1-difluoro-7-methyloct-6-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146430754 |
| Molecular Formula | C26H37ClF2N2O2 |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | tert-butyl 3-[6-[(E)-2-chloro-2-(2-methyl-3-pyridinyl)ethenyl]-1,1-difluoro-7-methyloct-6-enyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)=C(/C=C(/Cl)c1cccnc1C)CCCCC(F)(F)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H37ClF2N2O2/c1-18(2)20(16-23(27)22-11-9-14-30-19(22)3)10-7-8-13-26(28,29)21-12-15-31(17-21)24(32)33-25(4,5)6/h9,11,14,16,21H,7-8,10,12-13,15,17H2,1-6H3/b23-16+ |
| InChIKey | ZSPUSYUXFCSOND-XQNSMLJCSA-N |
| XLogP | 7.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|