C28H36F3N5O4 — CID 146431652
(2S)-2-[4-[(2S)-oxan-2-yl]-2-(trifluoromethyl)pyrimidin-5-yl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146431652) has the molecular formula C28H36F3N5O4 and a molecular weight of 563.62 g/mol. Its IUPAC name is (2S)-2-[4-[(2S)-oxan-2-yl]-2-(trifluoromethyl)pyrimidin-5-yl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[4-[(2S)-oxan-2-yl]-2-(trifluoromethyl)pyrimidin-5-yl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146431652 |
| Molecular Formula | C28H36F3N5O4 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | (2S)-2-[4-[(2S)-oxan-2-yl]-2-(trifluoromethyl)pyrimidin-5-yl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@H](c1cnc(C(F)(F)F)nc1[C@@H]1CCCCO1)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C28H36F3N5O4/c29-28(30,31)27-33-16-21(23(35-27)22-8-2-4-15-40-22)24(26(37)38)36-13-11-20(17-36)39-14-3-1-7-19-10-9-18-6-5-12-32-25(18)34-19/h9-10,16,20,22,24H,1-8,11-15,17H2,(H,32,34)(H,37,38)/t20-,22+,24+/m1/s1 |
| InChIKey | UYKORHGMGXUFLQ-SFLYRZDNSA-N |
| XLogP | 4.73 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|