C49H35N3O2 — CID 146431769
2-[3-[3-(12-tert-butyl-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-6-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 146431769) has the molecular formula C49H35N3O2 and a molecular weight of 697.84 g/mol. Its IUPAC name is 2-[3-[3-(12-tert-butyl-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-6-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-(12-tert-butyl-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-6-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146431769 |
| Molecular Formula | C49H35N3O2 |
| Molecular Weight | 697.84 g/mol |
| Exact Mass | 697.27 |
| IUPAC Name | 2-[3-[3-(12-tert-butyl-10,14-dioxapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-6-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC(C)(C)c1c2oc3ccccc3c2cc2c1oc1ccc(-c3cccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)cc12 |
| InChI | InChI=1S/C49H35N3O2/c1-49(2,3)43-44-39(37-22-10-11-23-41(37)53-44)29-40-38-28-35(24-25-42(38)54-45(40)43)33-19-12-18-32(26-33)34-20-13-21-36(27-34)48-51-46(30-14-6-4-7-15-30)50-47(52-48)31-16-8-5-9-17-31/h4-29H,1-3H3 |
| InChIKey | QVVBJBZJIULPAX-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.84 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |