C33H44FN3O5 — CID 146431834
(2R)-2-[2-[(3S)-2,9-dioxaspiro[5.5]undecan-3-yl]-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146431834) has the molecular formula C33H44FN3O5 and a molecular weight of 581.73 g/mol. Its IUPAC name is (2R)-2-[2-[(3S)-2,9-dioxaspiro[5.5]undecan-3-yl]-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2R)-2-[2-[(3S)-2,9-dioxaspiro[5.5]undecan-3-yl]-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146431834 |
| Molecular Formula | C33H44FN3O5 |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | (2R)-2-[2-[(3S)-2,9-dioxaspiro[5.5]undecan-3-yl]-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@@H](c1cc(F)ccc1[C@@H]1CCC2(CCOCC2)CO1)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C33H44FN3O5/c34-24-7-9-27(29-10-12-33(22-42-29)13-18-40-19-14-33)28(20-24)30(32(38)39)37-16-11-26(21-37)41-17-2-1-5-25-8-6-23-4-3-15-35-31(23)36-25/h6-9,20,26,29-30H,1-5,10-19,21-22H2,(H,35,36)(H,38,39)/t26-,29+,30-/m1/s1 |
| InChIKey | ANWFPCVOKUPDKA-JJZPZGAKSA-N |
| XLogP | 5.47 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|