About tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate
tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate (PubChem CID 146431835) has the molecular formula C19H35NO4
and a molecular weight of 341.49 g/mol. Its IUPAC name is tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate |
| PubChem CID | 146431835 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCCCCC2(C)OCCO2)C1 |
| InChI | InChI=1S/C19H35NO4/c1-18(2,3)24-17(21)20-12-10-16(15-20)9-7-5-6-8-11-19(4)22-13-14-23-19/h16H,5-15H2,1-4H3 |
| InChIKey | ALKLZRIXDZQWGP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate (CID 146431835) is tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(CCCCCCC2(C)OCCO2)C1.
What is the InChIKey of tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate?
The InChIKey is ALKLZRIXDZQWGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO4/c1-18(2,3)24-17(21)20-12-10-16(15-20)9-7-5-6-8-11-19(4)22-13-14-23-19/h16H,5-15H2,1-4H3.
What are the key properties of tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate?
tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate has a molecular weight of 341.49 g/mol, XLogP of 4.35, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[6-(2-methyl-1,3-dioxolan-2-yl)hexyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 146431835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).