C31H42FN3O4 — CID 146431879
(2S)-2-[2-[(2S)-5,5-dimethyloxan-2-yl]-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146431879) has the molecular formula C31H42FN3O4 and a molecular weight of 539.69 g/mol. Its IUPAC name is (2S)-2-[2-[(2S)-5,5-dimethyloxan-2-yl]-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[2-[(2S)-5,5-dimethyloxan-2-yl]-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146431879 |
| Molecular Formula | C31H42FN3O4 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | (2S)-2-[2-[(2S)-5,5-dimethyloxan-2-yl]-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | CC1(C)CC[C@@H](c2ccc(F)cc2[C@@H](C(=O)O)N2CC[C@@H](OCCCCc3ccc4c(n3)NCCC4)C2)OC1 |
| InChI | InChI=1S/C31H42FN3O4/c1-31(2)14-12-27(39-20-31)25-11-9-22(32)18-26(25)28(30(36)37)35-16-13-24(19-35)38-17-4-3-7-23-10-8-21-6-5-15-33-29(21)34-23/h8-11,18,24,27-28H,3-7,12-17,19-20H2,1-2H3,(H,33,34)(H,36,37)/t24-,27+,28+/m1/s1 |
| InChIKey | ZWIIQUQRJMVXAG-KGPYPHOUSA-N |
| XLogP | 5.70 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|