C22H20N4O5 — CID 146432459
(2,5-dioxopyrrolidin-1-yl) 2-[4-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate (PubChem CID 146432459) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[4-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 146432459 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[4-[(2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carbonyl)amino]phenyl]acetate |
| SMILES | Cc1cc(C)n2ccc(C(=O)Nc3ccc(CC(=O)ON4C(=O)CCC4=O)cc3)c2n1 |
| InChI | InChI=1S/C22H20N4O5/c1-13-11-14(2)25-10-9-17(21(25)23-13)22(30)24-16-5-3-15(4-6-16)12-20(29)31-26-18(27)7-8-19(26)28/h3-6,9-11H,7-8,12H2,1-2H3,(H,24,30) |
| InChIKey | JZXIKCVZTPHVLF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|