C30H41FN4O4 — CID 146433083
(2S)-2-[2-[(2S)-5,5-dimethyloxan-2-yl]-5-fluoro-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146433083) has the molecular formula C30H41FN4O4 and a molecular weight of 540.68 g/mol. Its IUPAC name is (2S)-2-[2-[(2S)-5,5-dimethyloxan-2-yl]-5-fluoro-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[2-[(2S)-5,5-dimethyloxan-2-yl]-5-fluoro-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146433083 |
| Molecular Formula | C30H41FN4O4 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (2S)-2-[2-[(2S)-5,5-dimethyloxan-2-yl]-5-fluoro-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | CC1(C)CC[C@@H](c2ncc(F)cc2[C@@H](C(=O)O)N2CC[C@@H](OCCCCc3ccc4c(n3)NCCC4)C2)OC1 |
| InChI | InChI=1S/C30H41FN4O4/c1-30(2)12-10-25(39-19-30)26-24(16-21(31)17-33-26)27(29(36)37)35-14-11-23(18-35)38-15-4-3-7-22-9-8-20-6-5-13-32-28(20)34-22/h8-9,16-17,23,25,27H,3-7,10-15,18-19H2,1-2H3,(H,32,34)(H,36,37)/t23-,25+,27+/m1/s1 |
| InChIKey | LKPHGIJCTWXAMI-NIYJGHKDSA-N |
| XLogP | 5.09 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|