C33H42F3N3O3 — CID 146433088
(2S)-2-[2-(2,2-difluorospiro[3.5]nonan-7-yl)-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146433088) has the molecular formula C33H42F3N3O3 and a molecular weight of 585.71 g/mol. Its IUPAC name is (2S)-2-[2-(2,2-difluorospiro[3.5]nonan-7-yl)-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[2-(2,2-difluorospiro[3.5]nonan-7-yl)-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146433088 |
| Molecular Formula | C33H42F3N3O3 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | (2S)-2-[2-(2,2-difluorospiro[3.5]nonan-7-yl)-5-fluorophenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@H](c1cc(F)ccc1C1CCC2(CC1)CC(F)(F)C2)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C33H42F3N3O3/c34-24-7-9-27(22-10-13-32(14-11-22)20-33(35,36)21-32)28(18-24)29(31(40)41)39-16-12-26(19-39)42-17-2-1-5-25-8-6-23-4-3-15-37-30(23)38-25/h6-9,18,22,26,29H,1-5,10-17,19-21H2,(H,37,38)(H,40,41)/t26-,29+/m1/s1 |
| InChIKey | LHBIUNXVPHZXGQ-UHSQPCAPSA-N |
| XLogP | 6.89 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|