About (2R)-5,5-difluoro-2-prop-1-en-2-yloxane
(2R)-5,5-difluoro-2-prop-1-en-2-yloxane (PubChem CID 146433106) has the molecular formula C8H12F2O
and a molecular weight of 162.18 g/mol. Its IUPAC name is (2R)-5,5-difluoro-2-prop-1-en-2-yloxane.
Molecular Properties
| Compound Name | (2R)-5,5-difluoro-2-prop-1-en-2-yloxane |
| PubChem CID | 146433106 |
| Molecular Formula | C8H12F2O |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (2R)-5,5-difluoro-2-prop-1-en-2-yloxane |
| SMILES | C=C(C)[C@H]1CCC(F)(F)CO1 |
| InChI | InChI=1S/C8H12F2O/c1-6(2)7-3-4-8(9,10)5-11-7/h7H,1,3-5H2,2H3/t7-/m1/s1 |
| InChIKey | VMIHQXGVWCCSLS-SSDOTTSWSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-5,5-difluoro-2-prop-1-en-2-yloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5,5-difluoro-2-prop-1-en-2-yloxane?
The IUPAC name of (2R)-5,5-difluoro-2-prop-1-en-2-yloxane (CID 146433106) is (2R)-5,5-difluoro-2-prop-1-en-2-yloxane.
What is the SMILES notation for (2R)-5,5-difluoro-2-prop-1-en-2-yloxane?
The canonical SMILES for (2R)-5,5-difluoro-2-prop-1-en-2-yloxane is C=C(C)[C@H]1CCC(F)(F)CO1.
What is the InChIKey of (2R)-5,5-difluoro-2-prop-1-en-2-yloxane?
The InChIKey is VMIHQXGVWCCSLS-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H12F2O/c1-6(2)7-3-4-8(9,10)5-11-7/h7H,1,3-5H2,2H3/t7-/m1/s1.
What are the key properties of (2R)-5,5-difluoro-2-prop-1-en-2-yloxane?
(2R)-5,5-difluoro-2-prop-1-en-2-yloxane has a molecular weight of 162.18 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5,5-difluoro-2-prop-1-en-2-yloxane is sourced from PubChem (CID 146433106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).