C27H36FN3O3 — CID 146433159
2-(2-cyclopropyl-6-fluorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]ethane-1,1-diol (PubChem CID 146433159) has the molecular formula C27H36FN3O3 and a molecular weight of 469.60 g/mol. Its IUPAC name is 2-(2-cyclopropyl-6-fluorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]ethane-1,1-diol.
| Compound Name | 2-(2-cyclopropyl-6-fluorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 146433159 |
| Molecular Formula | C27H36FN3O3 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-(2-cyclopropyl-6-fluorophenyl)-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]ethane-1,1-diol |
| SMILES | OC(O)C(c1c(F)cccc1C1CC1)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C27H36FN3O3/c28-23-8-3-7-22(18-9-10-18)24(23)25(27(32)33)31-15-13-21(17-31)34-16-2-1-6-20-12-11-19-5-4-14-29-26(19)30-20/h3,7-8,11-12,18,21,25,27,32-33H,1-2,4-6,9-10,13-17H2,(H,29,30)/t21-,25?/m1/s1 |
| InChIKey | AONSYMBPYXRUSE-JGKWMGOWSA-N |
| XLogP | 3.92 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|