C32H38F3N3O3 — CID 146433183
(6R,9S,13bS)-1',1',11-trifluoro-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]spiro[1,2,4,5,6,7,9,13b-octahydropyrrolo[2,1-e]phenanthridine-3,3'-cyclobutane]-9-carboxylic acid (PubChem CID 146433183) has the molecular formula C32H38F3N3O3 and a molecular weight of 569.67 g/mol. Its IUPAC name is (6R,9S,13bS)-1',1',11-trifluoro-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]spiro[1,2,4,5,6,7,9,13b-octahydropyrrolo[2,1-e]phenanthridine-3,3'-cyclobutane]-9-carboxylic acid.
| Compound Name | (6R,9S,13bS)-1',1',11-trifluoro-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]spiro[1,2,4,5,6,7,9,13b-octahydropyrrolo[2,1-e]phenanthridine-3,3'-cyclobutane]-9-carboxylic acid |
|---|---|
| PubChem CID | 146433183 |
| Molecular Formula | C32H38F3N3O3 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | (6R,9S,13bS)-1',1',11-trifluoro-6-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]spiro[1,2,4,5,6,7,9,13b-octahydropyrrolo[2,1-e]phenanthridine-3,3'-cyclobutane]-9-carboxylic acid |
| SMILES | O=C(O)[C@@H]1c2cc(F)ccc2[C@@H]2CCC3(CC(F)(F)C3)CC23C[C@@H](OCCCCc2ccc4c(n2)NCCC4)CN13 |
| InChI | InChI=1S/C32H38F3N3O3/c33-21-7-9-24-25(14-21)27(29(39)40)38-16-23(15-31(38)17-30(11-10-26(24)31)18-32(34,35)19-30)41-13-2-1-5-22-8-6-20-4-3-12-36-28(20)37-22/h6-9,14,23,26-27H,1-5,10-13,15-19H2,(H,36,37)(H,39,40)/t23-,26+,27+,31?/m1/s1 |
| InChIKey | NROKLQSWTZWIOG-WOAJTTNTSA-N |
| XLogP | 6.25 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|