C28H36FN3O4 — CID 146433712
(2S)-2-[(3S)-7-fluoro-3-methyl-3,4-dihydro-2H-chromen-5-yl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146433712) has the molecular formula C28H36FN3O4 and a molecular weight of 497.61 g/mol. Its IUPAC name is (2S)-2-[(3S)-7-fluoro-3-methyl-3,4-dihydro-2H-chromen-5-yl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | (2S)-2-[(3S)-7-fluoro-3-methyl-3,4-dihydro-2H-chromen-5-yl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146433712 |
| Molecular Formula | C28H36FN3O4 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | (2S)-2-[(3S)-7-fluoro-3-methyl-3,4-dihydro-2H-chromen-5-yl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | C[C@@H]1COc2cc(F)cc([C@@H](C(=O)O)N3CC[C@@H](OCCCCc4ccc5c(n4)NCCC5)C3)c2C1 |
| InChI | InChI=1S/C28H36FN3O4/c1-18-13-23-24(14-20(29)15-25(23)36-17-18)26(28(33)34)32-11-9-22(16-32)35-12-3-2-6-21-8-7-19-5-4-10-30-27(19)31-21/h7-8,14-15,18,22,26H,2-6,9-13,16-17H2,1H3,(H,30,31)(H,33,34)/t18-,22+,26-/m0/s1 |
| InChIKey | UCIBMQKUCYLAIO-MNDLBQGCSA-N |
| XLogP | 4.39 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|