About 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide
4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide (PubChem CID 146434260) has the molecular formula C22H28N2O4
and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide |
| PubChem CID | 146434260 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NC2CCC(OC)CC2)c([C@@H](C)c2ccccc2)o1 |
| InChI | InChI=1S/C22H28N2O4/c1-14(15-7-5-4-6-8-15)20-18(13-19(28-20)22(26)23-2)21(25)24-16-9-11-17(27-3)12-10-16/h4-8,13-14,16-17H,9-12H2,1-3H3,(H,23,26)(H,24,25)/t14-,16?,17?/m0/s1 |
| InChIKey | JUMIVXBFUOSHAD-OOHWJJMZSA-N |
| XLogP | 3.48 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide?
The IUPAC name of 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide (CID 146434260) is 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide.
What is the SMILES notation for 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide?
The canonical SMILES for 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide is CNC(=O)c1cc(C(=O)NC2CCC(OC)CC2)c([C@@H](C)c2ccccc2)o1.
What is the InChIKey of 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide?
The InChIKey is JUMIVXBFUOSHAD-OOHWJJMZSA-N. The full InChI is InChI=1S/C22H28N2O4/c1-14(15-7-5-4-6-8-15)20-18(13-19(28-20)22(26)23-2)21(25)24-16-9-11-17(27-3)12-10-16/h4-8,13-14,16-17H,9-12H2,1-3H3,(H,23,26)(H,24,25)/t14-,16?,17?/m0/s1.
What are the key properties of 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide?
4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide has a molecular weight of 384.48 g/mol, XLogP of 3.48, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-methoxycyclohexyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide is sourced from PubChem (CID 146434260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).