C10H14F2N2S — CID 146435255
4-[2-(difluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-amine (PubChem CID 146435255) has the molecular formula C10H14F2N2S and a molecular weight of 232.30 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-amine.
| Compound Name | 4-[2-(difluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 146435255 |
| Molecular Formula | C10H14F2N2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-[2-(difluoromethyl)-1,3-thiazol-5-yl]cyclohexan-1-amine |
| SMILES | NC1CCC(c2cnc(C(F)F)s2)CC1 |
| InChI | InChI=1S/C10H14F2N2S/c11-9(12)10-14-5-8(15-10)6-1-3-7(13)4-2-6/h5-7,9H,1-4,13H2 |
| InChIKey | LBAIMYXDAXDYKJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |