C25H48N2 — CID 146435445
(1S,2S)-3-tert-butyl-2-[1-[(3R,4S,5S)-5-tert-butyl-1,3,4-trimethylpyrrolidin-2-yl]-2-methylpropan-2-yl]-3-azabicyclo[4.1.0]heptane (PubChem CID 146435445) has the molecular formula C25H48N2 and a molecular weight of 376.67 g/mol. Its IUPAC name is (1S,2S)-3-tert-butyl-2-[1-[(3R,4S,5S)-5-tert-butyl-1,3,4-trimethylpyrrolidin-2-yl]-2-methylpropan-2-yl]-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1S,2S)-3-tert-butyl-2-[1-[(3R,4S,5S)-5-tert-butyl-1,3,4-trimethylpyrrolidin-2-yl]-2-methylpropan-2-yl]-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 146435445 |
| Molecular Formula | C25H48N2 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.38 |
| IUPAC Name | (1S,2S)-3-tert-butyl-2-[1-[(3R,4S,5S)-5-tert-butyl-1,3,4-trimethylpyrrolidin-2-yl]-2-methylpropan-2-yl]-3-azabicyclo[4.1.0]heptane |
| SMILES | C[C@@H]1[C@@H](C(C)(C)C)N(C)C(CC(C)(C)[C@@H]2[C@H]3CC3CCN2C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C25H48N2/c1-16-17(2)21(23(3,4)5)26(11)20(16)15-25(9,10)22-19-14-18(19)12-13-27(22)24(6,7)8/h16-22H,12-15H2,1-11H3/t16-,17+,18?,19+,20?,21+,22+/m1/s1 |
| InChIKey | AVRQMEMGRMSHKC-SQPWWIFISA-N |
| XLogP | 5.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |