C13H27FN2 — CID 146435543
[(2R,3R,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-2-yl]methanamine (PubChem CID 146435543) has the molecular formula C13H27FN2 and a molecular weight of 230.37 g/mol. Its IUPAC name is [(2R,3R,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-2-yl]methanamine.
| Compound Name | [(2R,3R,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 146435543 |
| Molecular Formula | C13H27FN2 |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | [(2R,3R,5S)-1,5-ditert-butyl-3-fluoropyrrolidin-2-yl]methanamine |
| SMILES | CC(C)(C)[C@@H]1C[C@@H](F)[C@@H](CN)N1C(C)(C)C |
| InChI | InChI=1S/C13H27FN2/c1-12(2,3)11-7-9(14)10(8-15)16(11)13(4,5)6/h9-11H,7-8,15H2,1-6H3/t9-,10-,11+/m1/s1 |
| InChIKey | YHJLEFHWGBIUJT-MXWKQRLJSA-N |
| XLogP | 2.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |