C24H38S — CID 146435945
dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-[3-(2,3,3-trimethylpent-4-en-2-yl)cyclopenta-2,4-dien-1-yl]-λ4-sulfane (PubChem CID 146435945) has the molecular formula C24H38S and a molecular weight of 358.64 g/mol. Its IUPAC name is dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-[3-(2,3,3-trimethylpent-4-en-2-yl)cyclopenta-2,4-dien-1-yl]-λ4-sulfane.
| Compound Name | dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-[3-(2,3,3-trimethylpent-4-en-2-yl)cyclopenta-2,4-dien-1-yl]-λ4-sulfane |
|---|---|
| PubChem CID | 146435945 |
| Molecular Formula | C24H38S |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)-[3-(2,3,3-trimethylpent-4-en-2-yl)cyclopenta-2,4-dien-1-yl]-λ4-sulfane |
| SMILES | C=CC(C)(C)C(C)(C)C1=CC(S(C)(C)C2C(C)=C(C)C(C)=C2C)C=C1 |
| InChI | InChI=1S/C24H38S/c1-12-23(6,7)24(8,9)20-13-14-21(15-20)25(10,11)22-18(4)16(2)17(3)19(22)5/h12-15,21-22H,1H2,2-11H3 |
| InChIKey | ZIZRWRAALAMDII-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|