C28H35NO2 — CID 146436393
(E)-1-cyclobutyl-2-[(1S)-3-[2-oxo-2-(1,2,2-trimethyl-3H-cyclohepta[b]pyrrol-5-yl)ethyl]cyclohex-3-en-1-yl]but-2-en-1-one (PubChem CID 146436393) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is (E)-1-cyclobutyl-2-[(1S)-3-[2-oxo-2-(1,2,2-trimethyl-3H-cyclohepta[b]pyrrol-5-yl)ethyl]cyclohex-3-en-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-cyclobutyl-2-[(1S)-3-[2-oxo-2-(1,2,2-trimethyl-3H-cyclohepta[b]pyrrol-5-yl)ethyl]cyclohex-3-en-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 146436393 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | (E)-1-cyclobutyl-2-[(1S)-3-[2-oxo-2-(1,2,2-trimethyl-3H-cyclohepta[b]pyrrol-5-yl)ethyl]cyclohex-3-en-1-yl]but-2-en-1-one |
| SMILES | C/C=C(/C(=O)C1CCC1)[C@H]1CCC=C(CC(=O)C2=CC3=C(C=C=C2)N(C)C(C)(C)C3)C1 |
| InChI | InChI=1S/C28H35NO2/c1-5-24(27(31)20-10-7-11-20)21-12-6-9-19(15-21)16-26(30)22-13-8-14-25-23(17-22)18-28(2,3)29(25)4/h5,9,13-14,17,20-21H,6-7,10-12,15-16,18H2,1-4H3/b24-5+/t21-/m0/s1 |
| InChIKey | KJUJMAZNSLULKD-WCIWWMPCSA-N |
| XLogP | 6.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|