C26H10N4 — CID 146436976
pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-9,10,11,12-tetracarbonitrile (PubChem CID 146436976) has the molecular formula C26H10N4 and a molecular weight of 378.39 g/mol. Its IUPAC name is pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-9,10,11,12-tetracarbonitrile.
| Compound Name | pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-9,10,11,12-tetracarbonitrile |
|---|---|
| PubChem CID | 146436976 |
| Molecular Formula | C26H10N4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaene-9,10,11,12-tetracarbonitrile |
| SMILES | N#Cc1c(C#N)c(C#N)c2c(c1C#N)c1ccccc1c1ccc3ccccc3c12 |
| InChI | InChI=1S/C26H10N4/c27-11-20-21(12-28)23(14-30)26-24-16-6-2-1-5-15(16)9-10-19(24)17-7-3-4-8-18(17)25(26)22(20)13-29/h1-10H |
| InChIKey | BQBXBYVQJOOHNO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|