About (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine
(2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine (PubChem CID 146437046) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine.
Molecular Properties
| Compound Name | (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine |
| PubChem CID | 146437046 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine |
| SMILES | C=c1nccn/c1=C/C(C)=C(C)C |
| InChI | InChI=1S/C11H14N2/c1-8(2)9(3)7-11-10(4)12-5-6-13-11/h5-7H,4H2,1-3H3/b11-7+ |
| InChIKey | WPSLZIZVZIHBFC-YRNVUSSQSA-N |
| XLogP | 1.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine?
The IUPAC name of (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine (CID 146437046) is (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine.
What is the SMILES notation for (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine?
The canonical SMILES for (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine is C=c1nccn/c1=C/C(C)=C(C)C.
What is the InChIKey of (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine?
The InChIKey is WPSLZIZVZIHBFC-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H14N2/c1-8(2)9(3)7-11-10(4)12-5-6-13-11/h5-7H,4H2,1-3H3/b11-7+.
What are the key properties of (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine?
(2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine has a molecular weight of 174.25 g/mol, XLogP of 1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(2,3-dimethylbut-2-enylidene)-3-methylidenepyrazine is sourced from PubChem (CID 146437046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).