C27H28N8O2 — CID 146437177
3-tert-butyl-N-[6-[2-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 146437177) has the molecular formula C27H28N8O2 and a molecular weight of 496.58 g/mol. Its IUPAC name is 3-tert-butyl-N-[6-[2-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-tert-butyl-N-[6-[2-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 146437177 |
| Molecular Formula | C27H28N8O2 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 3-tert-butyl-N-[6-[2-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cn1cc(-c2nc3nccc(-c4ccc5c(c4)CCCC5NC(=O)c4nc(C(C)(C)C)no4)c3[nH]2)cn1 |
| InChI | InChI=1S/C27H28N8O2/c1-27(2,3)26-33-25(37-34-26)24(36)30-20-7-5-6-15-12-16(8-9-18(15)20)19-10-11-28-23-21(19)31-22(32-23)17-13-29-35(4)14-17/h8-14,20H,5-7H2,1-4H3,(H,30,36)(H,28,31,32) |
| InChIKey | GAVDTIOVHBDWGP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |