C16H30N2O — CID 146437443
N-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-4-ethyl-2,2,4-trimethylhexanamide (PubChem CID 146437443) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is N-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-4-ethyl-2,2,4-trimethylhexanamide.
| Compound Name | N-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-4-ethyl-2,2,4-trimethylhexanamide |
|---|---|
| PubChem CID | 146437443 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | N-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-4-ethyl-2,2,4-trimethylhexanamide |
| SMILES | C/C=C(\C=C/N)NC(=O)C(C)(C)CC(C)(CC)CC |
| InChI | InChI=1S/C16H30N2O/c1-7-13(10-11-17)18-14(19)15(4,5)12-16(6,8-2)9-3/h7,10-11H,8-9,12,17H2,1-6H3,(H,18,19)/b11-10-,13-7+ |
| InChIKey | JUZJPKHGYVONTK-PCGFSOLGSA-N |
| XLogP | 3.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|