C18H26F4O — CID 146437484
2-methyl-4-(2-methylbutan-2-yl)-1-(1,1,2,2-tetrafluoro-3,3-dimethylbutoxy)benzene (PubChem CID 146437484) has the molecular formula C18H26F4O and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-methyl-4-(2-methylbutan-2-yl)-1-(1,1,2,2-tetrafluoro-3,3-dimethylbutoxy)benzene.
| Compound Name | 2-methyl-4-(2-methylbutan-2-yl)-1-(1,1,2,2-tetrafluoro-3,3-dimethylbutoxy)benzene |
|---|---|
| PubChem CID | 146437484 |
| Molecular Formula | C18H26F4O |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-methyl-4-(2-methylbutan-2-yl)-1-(1,1,2,2-tetrafluoro-3,3-dimethylbutoxy)benzene |
| SMILES | CCC(C)(C)c1ccc(OC(F)(F)C(F)(F)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H26F4O/c1-8-16(6,7)13-9-10-14(12(2)11-13)23-18(21,22)17(19,20)15(3,4)5/h9-11H,8H2,1-7H3 |
| InChIKey | CDURIRUFYYHLSH-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|