About methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate
methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (PubChem CID 146437537) has the molecular formula C12H16N2O2S
and a molecular weight of 252.34 g/mol. Its IUPAC name is methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
| PubChem CID | 146437537 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate |
| SMILES | COC(=O)N1C=Cc2nc(C(C)(C)C)sc2C1 |
| InChI | InChI=1S/C12H16N2O2S/c1-12(2,3)10-13-8-5-6-14(11(15)16-4)7-9(8)17-10/h5-6H,7H2,1-4H3 |
| InChIKey | SUGLTWUDMNFIGB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate?
The IUPAC name of methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate (CID 146437537) is methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate.
What is the SMILES notation for methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate?
The canonical SMILES for methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate is COC(=O)N1C=Cc2nc(C(C)(C)C)sc2C1.
What is the InChIKey of methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate?
The InChIKey is SUGLTWUDMNFIGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2S/c1-12(2,3)10-13-8-5-6-14(11(15)16-4)7-9(8)17-10/h5-6H,7H2,1-4H3.
What are the key properties of methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate?
methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate has a molecular weight of 252.34 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-tert-butyl-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxylate is sourced from PubChem (CID 146437537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).