C11H13ClO3 — CID 14643759
[(2Z)-2-(2-chloro-3,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)ethyl] acetate (PubChem CID 14643759) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is [(2Z)-2-(2-chloro-3,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)ethyl] acetate.
| Compound Name | [(2Z)-2-(2-chloro-3,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)ethyl] acetate |
|---|---|
| PubChem CID | 14643759 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | [(2Z)-2-(2-chloro-3,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)ethyl] acetate |
| SMILES | CC(=O)OC/C=C1/C(=O)C(C)=C(C)C1Cl |
| InChI | InChI=1S/C11H13ClO3/c1-6-7(2)11(14)9(10(6)12)4-5-15-8(3)13/h4,10H,5H2,1-3H3/b9-4+ |
| InChIKey | BTKGXLGZJHDNOB-RUDMXATFSA-N |
| XLogP | 2.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|