About 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one
2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one (PubChem CID 146437699) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one.
Molecular Properties
| Compound Name | 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one |
| PubChem CID | 146437699 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one |
| SMILES | CC(C)(C)C1=NC2=C(C1)C(=O)C(O)C=C2 |
| InChI | InChI=1S/C12H15NO2/c1-12(2,3)10-6-7-8(13-10)4-5-9(14)11(7)15/h4-5,9,14H,6H2,1-3H3 |
| InChIKey | SWDJSGQMCXGUIU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one?
The IUPAC name of 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one (CID 146437699) is 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one.
What is the SMILES notation for 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one?
The canonical SMILES for 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one is CC(C)(C)C1=NC2=C(C1)C(=O)C(O)C=C2.
What is the InChIKey of 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one?
The InChIKey is SWDJSGQMCXGUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-12(2,3)10-6-7-8(13-10)4-5-9(14)11(7)15/h4-5,9,14H,6H2,1-3H3.
What are the key properties of 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one?
2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one has a molecular weight of 205.26 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-hydroxy-3,5-dihydroindol-4-one is sourced from PubChem (CID 146437699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).