About methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate
methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate (PubChem CID 146437876) has the molecular formula C11H6Cl2F3N3O2
and a molecular weight of 340.09 g/mol. Its IUPAC name is methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate |
| PubChem CID | 146437876 |
| Molecular Formula | C11H6Cl2F3N3O2 |
| Molecular Weight | 340.09 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2ccc(Cl)c(C(F)(F)F)c2Cl)nn1 |
| InChI | InChI=1S/C11H6Cl2F3N3O2/c1-21-10(20)6-4-19(18-17-6)7-3-2-5(12)8(9(7)13)11(14,15)16/h2-4H,1H3 |
| InChIKey | ODKUTOHELUJORF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.09 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate?
The IUPAC name of methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate (CID 146437876) is methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate?
The canonical SMILES for methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate is COC(=O)c1cn(-c2ccc(Cl)c(C(F)(F)F)c2Cl)nn1.
What is the InChIKey of methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate?
The InChIKey is ODKUTOHELUJORF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl2F3N3O2/c1-21-10(20)6-4-19(18-17-6)7-3-2-5(12)8(9(7)13)11(14,15)16/h2-4H,1H3.
What are the key properties of methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate?
methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate has a molecular weight of 340.09 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2,4-dichloro-3-(trifluoromethyl)phenyl]triazole-4-carboxylate is sourced from PubChem (CID 146437876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).