About 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine
1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine (PubChem CID 146437890) has the molecular formula C15H18BrF2N
and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine.
Molecular Properties
| Compound Name | 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine |
| PubChem CID | 146437890 |
| Molecular Formula | C15H18BrF2N |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine |
| SMILES | Cc1c(Br)cccc1/C=C/CCN1CCC(F)(F)C1 |
| InChI | InChI=1S/C15H18BrF2N/c1-12-13(6-4-7-14(12)16)5-2-3-9-19-10-8-15(17,18)11-19/h2,4-7H,3,8-11H2,1H3/b5-2+ |
| InChIKey | FHRLOSBXGYBJMJ-GORDUTHDSA-N |
| XLogP | 4.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine?
The IUPAC name of 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine (CID 146437890) is 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine.
What is the SMILES notation for 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine?
The canonical SMILES for 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine is Cc1c(Br)cccc1/C=C/CCN1CCC(F)(F)C1.
What is the InChIKey of 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine?
The InChIKey is FHRLOSBXGYBJMJ-GORDUTHDSA-N. The full InChI is InChI=1S/C15H18BrF2N/c1-12-13(6-4-7-14(12)16)5-2-3-9-19-10-8-15(17,18)11-19/h2,4-7H,3,8-11H2,1H3/b5-2+.
What are the key properties of 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine?
1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine has a molecular weight of 330.22 g/mol, XLogP of 4.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-4-(3-bromo-2-methylphenyl)but-3-enyl]-3,3-difluoropyrrolidine is sourced from PubChem (CID 146437890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).